C20H20ClN3O — CID 108835864
(Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(2,4,6-trimethylanilino)prop-2-enamide (PubChem CID 108835864) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(2,4,6-trimethylanilino)prop-2-enamide.
| Compound Name | (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(2,4,6-trimethylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108835864 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(2,4,6-trimethylanilino)prop-2-enamide |
| SMILES | Cc1cc(C)c(N/C=C(/C#N)C(=O)NCc2ccccc2Cl)c(C)c1 |
| InChI | InChI=1S/C20H20ClN3O/c1-13-8-14(2)19(15(3)9-13)23-12-17(10-22)20(25)24-11-16-6-4-5-7-18(16)21/h4-9,12,23H,11H2,1-3H3,(H,24,25)/b17-12- |
| InChIKey | VPUUXNTXDSQHGF-ATVHPVEESA-N |
| XLogP | 4.40 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|