C14H15Cl2N3O — CID 108854639
(Z)-3-(2-chloro-4,6-dimethylanilino)-N-(2-chloroethyl)-2-cyanoprop-2-enamide (PubChem CID 108854639) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is (Z)-3-(2-chloro-4,6-dimethylanilino)-N-(2-chloroethyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(2-chloro-4,6-dimethylanilino)-N-(2-chloroethyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108854639 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (Z)-3-(2-chloro-4,6-dimethylanilino)-N-(2-chloroethyl)-2-cyanoprop-2-enamide |
| SMILES | Cc1cc(C)c(N/C=C(/C#N)C(=O)NCCCl)c(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2N3O/c1-9-5-10(2)13(12(16)6-9)19-8-11(7-17)14(20)18-4-3-15/h5-6,8,19H,3-4H2,1-2H3,(H,18,20)/b11-8- |
| InChIKey | TXJHMDAHWFPKFA-FLIBITNWSA-N |
| XLogP | 3.13 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|