C16H20ClN3O — CID 108837919
(Z)-N-tert-butyl-3-(2-chloro-4,6-dimethylanilino)-2-cyanoprop-2-enamide (PubChem CID 108837919) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is (Z)-N-tert-butyl-3-(2-chloro-4,6-dimethylanilino)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-tert-butyl-3-(2-chloro-4,6-dimethylanilino)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108837919 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (Z)-N-tert-butyl-3-(2-chloro-4,6-dimethylanilino)-2-cyanoprop-2-enamide |
| SMILES | Cc1cc(C)c(N/C=C(/C#N)C(=O)NC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C16H20ClN3O/c1-10-6-11(2)14(13(17)7-10)19-9-12(8-18)15(21)20-16(3,4)5/h6-7,9,19H,1-5H3,(H,20,21)/b12-9- |
| InChIKey | XZVSZXXCEJXSTC-XFXZXTDPSA-N |
| XLogP | 3.69 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|