C15H12ClN5O — CID 108835918
(Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enamide (PubChem CID 108835918) has the molecular formula C15H12ClN5O and a molecular weight of 313.75 g/mol. Its IUPAC name is (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108835918 |
| Molecular Formula | C15H12ClN5O |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ncccn1)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C15H12ClN5O/c16-13-5-2-1-4-11(13)9-20-14(22)12(8-17)10-21-15-18-6-3-7-19-15/h1-7,10H,9H2,(H,20,22)(H,18,19,21)/b12-10- |
| InChIKey | JZJTWWWIMFKKGY-BENRWUELSA-N |
| XLogP | 2.27 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|