C18H14ClN5O — CID 108836009
(Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(1H-indazol-6-ylamino)prop-2-enamide (PubChem CID 108836009) has the molecular formula C18H14ClN5O and a molecular weight of 351.80 g/mol. Its IUPAC name is (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(1H-indazol-6-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(1H-indazol-6-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108836009 |
| Molecular Formula | C18H14ClN5O |
| Molecular Weight | 351.80 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(1H-indazol-6-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc2cn[nH]c2c1)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C18H14ClN5O/c19-16-4-2-1-3-12(16)9-22-18(25)14(8-20)10-21-15-6-5-13-11-23-24-17(13)7-15/h1-7,10-11,21H,9H2,(H,22,25)(H,23,24)/b14-10- |
| InChIKey | ZUXXCZHXFUOMDO-UVTDQMKNSA-N |
| XLogP | 3.35 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.80 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|