C19H15N5O3 — CID 108841591
(Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-(1H-indazol-6-ylamino)prop-2-enamide (PubChem CID 108841591) has the molecular formula C19H15N5O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is (Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-(1H-indazol-6-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-(1H-indazol-6-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108841591 |
| Molecular Formula | C19H15N5O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (Z)-N-(1,3-benzodioxol-5-ylmethyl)-2-cyano-3-(1H-indazol-6-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc2cn[nH]c2c1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15N5O3/c20-7-14(9-21-15-3-2-13-10-23-24-16(13)6-15)19(25)22-8-12-1-4-17-18(5-12)27-11-26-17/h1-6,9-10,21H,8,11H2,(H,22,25)(H,23,24)/b14-9- |
| InChIKey | XGWIDNFZMBLBOP-ZROIWOOFSA-N |
| XLogP | 2.43 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|