C22H23N3O3 — CID 108841384
(Z)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-butylanilino)-2-cyanoprop-2-enamide (PubChem CID 108841384) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is (Z)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-butylanilino)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-butylanilino)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108841384 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (Z)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-butylanilino)-2-cyanoprop-2-enamide |
| SMILES | CCCCc1ccc(N/C=C(/C#N)C(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-2-3-4-16-5-8-19(9-6-16)24-14-18(12-23)22(26)25-13-17-7-10-20-21(11-17)28-15-27-20/h5-11,14,24H,2-4,13,15H2,1H3,(H,25,26)/b18-14- |
| InChIKey | UIXZPBMFCXJEDN-JXAWBTAJSA-N |
| XLogP | 3.89 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|