C20H14ClN3O — CID 59578757
(E)-N-[(2-chlorophenyl)methyl]-2-cyano-3-quinolin-4-ylprop-2-enamide (PubChem CID 59578757) has the molecular formula C20H14ClN3O and a molecular weight of 347.81 g/mol. Its IUPAC name is (E)-N-[(2-chlorophenyl)methyl]-2-cyano-3-quinolin-4-ylprop-2-enamide.
| Compound Name | (E)-N-[(2-chlorophenyl)methyl]-2-cyano-3-quinolin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 59578757 |
| Molecular Formula | C20H14ClN3O |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (E)-N-[(2-chlorophenyl)methyl]-2-cyano-3-quinolin-4-ylprop-2-enamide |
| SMILES | N#C/C(=C\c1ccnc2ccccc12)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C20H14ClN3O/c21-18-7-3-1-5-15(18)13-24-20(25)16(12-22)11-14-9-10-23-19-8-4-2-6-17(14)19/h1-11H,13H2,(H,24,25)/b16-11+ |
| InChIKey | MJAALJADGXSIOX-LFIBNONCSA-N |
| XLogP | 4.11 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|