C25H20BrClN2O3 — CID 3819567
N-benzyl-3-[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-2-cyanoprop-2-enamide (PubChem CID 3819567) has the molecular formula C25H20BrClN2O3 and a molecular weight of 511.80 g/mol. Its IUPAC name is N-benzyl-3-[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-2-cyanoprop-2-enamide.
| Compound Name | N-benzyl-3-[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 3819567 |
| Molecular Formula | C25H20BrClN2O3 |
| Molecular Weight | 511.80 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | N-benzyl-3-[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-2-cyanoprop-2-enamide |
| SMILES | COc1cc(C=C(C#N)C(=O)NCc2ccccc2)c(Br)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C25H20BrClN2O3/c1-31-23-12-19(11-20(14-28)25(30)29-15-17-7-3-2-4-8-17)21(26)13-24(23)32-16-18-9-5-6-10-22(18)27/h2-13H,15-16H2,1H3,(H,29,30) |
| InChIKey | KGYUHHRMHWPVTG-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.80 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|