C26H21BrN2O5 — CID 21167519
4-[[4-[(Z)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-5-bromo-2-methoxyphenoxy]methyl]benzoic acid (PubChem CID 21167519) has the molecular formula C26H21BrN2O5 and a molecular weight of 521.37 g/mol. Its IUPAC name is 4-[[4-[(Z)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-5-bromo-2-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-5-bromo-2-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 21167519 |
| Molecular Formula | C26H21BrN2O5 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | 4-[[4-[(Z)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-5-bromo-2-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C(/C#N)C(=O)NCc2ccccc2)c(Br)cc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H21BrN2O5/c1-33-23-12-20(11-21(14-28)25(30)29-15-17-5-3-2-4-6-17)22(27)13-24(23)34-16-18-7-9-19(10-8-18)26(31)32/h2-13H,15-16H2,1H3,(H,29,30)(H,31,32)/b21-11- |
| InChIKey | NWFZFABOMBMURZ-NHDPSOOVSA-N |
| XLogP | 4.96 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|