C17H15BrN2O3S — CID 94851061
(E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 94851061) has the molecular formula C17H15BrN2O3S and a molecular weight of 407.29 g/mol. Its IUPAC name is (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 94851061 |
| Molecular Formula | C17H15BrN2O3S |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | COc1cc(Br)c(/C=C(\C#N)C(=O)NCc2cccs2)cc1OC |
| InChI | InChI=1S/C17H15BrN2O3S/c1-22-15-7-11(14(18)8-16(15)23-2)6-12(9-19)17(21)20-10-13-4-3-5-24-13/h3-8H,10H2,1-2H3,(H,20,21)/b12-6+ |
| InChIKey | GNFIXMNSKAEVCX-WUXMJOGZSA-N |
| XLogP | 3.75 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|