C23H23N3O3S2 — CID 126203211
methyl 2-[3-[(E)-2-cyano-3-oxo-3-(thiophen-2-ylmethylamino)prop-1-enyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 126203211) has the molecular formula C23H23N3O3S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is methyl 2-[3-[(E)-2-cyano-3-oxo-3-(thiophen-2-ylmethylamino)prop-1-enyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[3-[(E)-2-cyano-3-oxo-3-(thiophen-2-ylmethylamino)prop-1-enyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 126203211 |
| Molecular Formula | C23H23N3O3S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | methyl 2-[3-[(E)-2-cyano-3-oxo-3-(thiophen-2-ylmethylamino)prop-1-enyl]-2,5-dimethylpyrrol-1-yl]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-n2c(C)cc(/C=C(\C#N)C(=O)NCc3cccs3)c2C)sc(C)c1C |
| InChI | InChI=1S/C23H23N3O3S2/c1-13-9-17(10-18(11-24)21(27)25-12-19-7-6-8-30-19)15(3)26(13)22-20(23(28)29-5)14(2)16(4)31-22/h6-10H,12H2,1-5H3,(H,25,27)/b18-10+ |
| InChIKey | YZPQTHMCOUQTGW-VCHYOVAHSA-N |
| XLogP | 4.84 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|