C20H22BrN3O2S — CID 1073588
(Z)-3-[5-bromo-4-(diethylamino)-2-methoxyphenyl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 1073588) has the molecular formula C20H22BrN3O2S and a molecular weight of 448.39 g/mol. Its IUPAC name is (Z)-3-[5-bromo-4-(diethylamino)-2-methoxyphenyl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-3-[5-bromo-4-(diethylamino)-2-methoxyphenyl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 1073588 |
| Molecular Formula | C20H22BrN3O2S |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | (Z)-3-[5-bromo-4-(diethylamino)-2-methoxyphenyl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | CCN(CC)c1cc(OC)c(/C=C(/C#N)C(=O)NCc2cccs2)cc1Br |
| InChI | InChI=1S/C20H22BrN3O2S/c1-4-24(5-2)18-11-19(26-3)14(10-17(18)21)9-15(12-22)20(25)23-13-16-7-6-8-27-16/h6-11H,4-5,13H2,1-3H3,(H,23,25)/b15-9- |
| InChIKey | PYOMMMDFPDHVKX-DHDCSXOGSA-N |
| XLogP | 4.59 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|