C22H20ClN3OS — CID 94851116
(E)-3-[1-(3-chloro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 94851116) has the molecular formula C22H20ClN3OS and a molecular weight of 409.94 g/mol. Its IUPAC name is (E)-3-[1-(3-chloro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[1-(3-chloro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 94851116 |
| Molecular Formula | C22H20ClN3OS |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (E)-3-[1-(3-chloro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | Cc1ccc(-n2c(C)cc(/C=C(\C#N)C(=O)NCc3cccs3)c2C)cc1Cl |
| InChI | InChI=1S/C22H20ClN3OS/c1-14-6-7-19(11-21(14)23)26-15(2)9-17(16(26)3)10-18(12-24)22(27)25-13-20-5-4-8-28-20/h4-11H,13H2,1-3H3,(H,25,27)/b18-10+ |
| InChIKey | JNPRSTXHGZNAQM-VCHYOVAHSA-N |
| XLogP | 5.34 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|