C21H18N6O — CID 112866755
N-[4-[[6-(quinolin-8-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 112866755) has the molecular formula C21H18N6O and a molecular weight of 370.42 g/mol. Its IUPAC name is N-[4-[[6-(quinolin-8-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[6-(quinolin-8-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112866755 |
| Molecular Formula | C21H18N6O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[4-[[6-(quinolin-8-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2cc(Nc3cccc4cccnc34)ncn2)cc1 |
| InChI | InChI=1S/C21H18N6O/c1-14(28)25-16-7-9-17(10-8-16)26-19-12-20(24-13-23-19)27-18-6-2-4-15-5-3-11-22-21(15)18/h2-13H,1H3,(H,25,28)(H2,23,24,26,27) |
| InChIKey | LUXCTJJCKQHWFD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |