C23H22N6 — CID 112866920
6-N-(4-pyrrolidin-1-ylphenyl)-4-N-quinolin-8-ylpyrimidine-4,6-diamine (PubChem CID 112866920) has the molecular formula C23H22N6 and a molecular weight of 382.47 g/mol. Its IUPAC name is 6-N-(4-pyrrolidin-1-ylphenyl)-4-N-quinolin-8-ylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(4-pyrrolidin-1-ylphenyl)-4-N-quinolin-8-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112866920 |
| Molecular Formula | C23H22N6 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 6-N-(4-pyrrolidin-1-ylphenyl)-4-N-quinolin-8-ylpyrimidine-4,6-diamine |
| SMILES | c1cnc2c(Nc3cc(Nc4ccc(N5CCCC5)cc4)ncn3)cccc2c1 |
| InChI | InChI=1S/C23H22N6/c1-2-14-29(13-1)19-10-8-18(9-11-19)27-21-15-22(26-16-25-21)28-20-7-3-5-17-6-4-12-24-23(17)20/h3-12,15-16H,1-2,13-14H2,(H2,25,26,27,28) |
| InChIKey | UWHXMVWGCYTINZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|