C24H24N6 — CID 112931777
6-methyl-2-N-(4-pyrrolidin-1-ylphenyl)-4-N-quinolin-8-ylpyrimidine-2,4-diamine (PubChem CID 112931777) has the molecular formula C24H24N6 and a molecular weight of 396.50 g/mol. Its IUPAC name is 6-methyl-2-N-(4-pyrrolidin-1-ylphenyl)-4-N-quinolin-8-ylpyrimidine-2,4-diamine.
| Compound Name | 6-methyl-2-N-(4-pyrrolidin-1-ylphenyl)-4-N-quinolin-8-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112931777 |
| Molecular Formula | C24H24N6 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 6-methyl-2-N-(4-pyrrolidin-1-ylphenyl)-4-N-quinolin-8-ylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2cccc3cccnc23)nc(Nc2ccc(N3CCCC3)cc2)n1 |
| InChI | InChI=1S/C24H24N6/c1-17-16-22(28-21-8-4-6-18-7-5-13-25-23(18)21)29-24(26-17)27-19-9-11-20(12-10-19)30-14-2-3-15-30/h4-13,16H,2-3,14-15H2,1H3,(H2,26,27,28,29) |
| InChIKey | AFYIGAZPJZCZII-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|