C21H22ClN5 — CID 112929622
4-N-(2-chlorophenyl)-6-methyl-2-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 112929622) has the molecular formula C21H22ClN5 and a molecular weight of 379.90 g/mol. Its IUPAC name is 4-N-(2-chlorophenyl)-6-methyl-2-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-chlorophenyl)-6-methyl-2-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112929622 |
| Molecular Formula | C21H22ClN5 |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-N-(2-chlorophenyl)-6-methyl-2-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccccc2Cl)nc(Nc2ccc(N3CCCC3)cc2)n1 |
| InChI | InChI=1S/C21H22ClN5/c1-15-14-20(25-19-7-3-2-6-18(19)22)26-21(23-15)24-16-8-10-17(11-9-16)27-12-4-5-13-27/h2-3,6-11,14H,4-5,12-13H2,1H3,(H2,23,24,25,26) |
| InChIKey | IZQSRLNJYYYUII-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|