C22H22N6 — CID 112866933
2-[[6-(4-piperidin-1-ylanilino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 112866933) has the molecular formula C22H22N6 and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-[[6-(4-piperidin-1-ylanilino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 2-[[6-(4-piperidin-1-ylanilino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112866933 |
| Molecular Formula | C22H22N6 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-[[6-(4-piperidin-1-ylanilino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1ccccc1Nc1cc(Nc2ccc(N3CCCCC3)cc2)ncn1 |
| InChI | InChI=1S/C22H22N6/c23-15-17-6-2-3-7-20(17)27-22-14-21(24-16-25-22)26-18-8-10-19(11-9-18)28-12-4-1-5-13-28/h2-3,6-11,14,16H,1,4-5,12-13H2,(H2,24,25,26,27) |
| InChIKey | HPDGKWLXXGRWHV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|