C22H24N4O — CID 109010517
2-(4-piperidin-1-ylanilino)-N-quinolin-8-ylacetamide (PubChem CID 109010517) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-(4-piperidin-1-ylanilino)-N-quinolin-8-ylacetamide.
| Compound Name | 2-(4-piperidin-1-ylanilino)-N-quinolin-8-ylacetamide |
|---|---|
| PubChem CID | 109010517 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-(4-piperidin-1-ylanilino)-N-quinolin-8-ylacetamide |
| SMILES | O=C(CNc1ccc(N2CCCCC2)cc1)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C22H24N4O/c27-21(25-20-8-4-6-17-7-5-13-23-22(17)20)16-24-18-9-11-19(12-10-18)26-14-2-1-3-15-26/h4-13,24H,1-3,14-16H2,(H,25,27) |
| InChIKey | SITUDMKJRQGTQR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|