C22H22N4O2 — CID 108527715
N-(4-piperidin-1-ylphenyl)-N'-quinolin-8-yloxamide (PubChem CID 108527715) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-(4-piperidin-1-ylphenyl)-N'-quinolin-8-yloxamide.
| Compound Name | N-(4-piperidin-1-ylphenyl)-N'-quinolin-8-yloxamide |
|---|---|
| PubChem CID | 108527715 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-(4-piperidin-1-ylphenyl)-N'-quinolin-8-yloxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C22H22N4O2/c27-21(22(28)25-19-8-4-6-16-7-5-13-23-20(16)19)24-17-9-11-18(12-10-17)26-14-2-1-3-15-26/h4-13H,1-3,14-15H2,(H,24,27)(H,25,28) |
| InChIKey | VFGSWJXPZBMDKP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|