C19H12F3N5 — CID 112867081
6-N-quinolin-8-yl-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine (PubChem CID 112867081) has the molecular formula C19H12F3N5 and a molecular weight of 367.33 g/mol. Its IUPAC name is 6-N-quinolin-8-yl-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-quinolin-8-yl-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112867081 |
| Molecular Formula | C19H12F3N5 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 6-N-quinolin-8-yl-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
| SMILES | Fc1ccc(Nc2cc(Nc3cccc4cccnc34)ncn2)c(F)c1F |
| InChI | InChI=1S/C19H12F3N5/c20-12-6-7-13(18(22)17(12)21)26-15-9-16(25-10-24-15)27-14-5-1-3-11-4-2-8-23-19(11)14/h1-10H,(H2,24,25,26,27) |
| InChIKey | ZQQZSWRHUCZODC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|