C21H13F3N4O — CID 109164848
6-(quinolin-8-ylamino)-N-(2,3,4-trifluorophenyl)pyridine-3-carboxamide (PubChem CID 109164848) has the molecular formula C21H13F3N4O and a molecular weight of 394.36 g/mol. Its IUPAC name is 6-(quinolin-8-ylamino)-N-(2,3,4-trifluorophenyl)pyridine-3-carboxamide.
| Compound Name | 6-(quinolin-8-ylamino)-N-(2,3,4-trifluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109164848 |
| Molecular Formula | C21H13F3N4O |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 6-(quinolin-8-ylamino)-N-(2,3,4-trifluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccc(Nc2cccc3cccnc23)nc1 |
| InChI | InChI=1S/C21H13F3N4O/c22-14-7-8-15(19(24)18(14)23)28-21(29)13-6-9-17(26-11-13)27-16-5-1-3-12-4-2-10-25-20(12)16/h1-11H,(H,26,27)(H,28,29) |
| InChIKey | GVHAYHQOPADVRN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|