C18H11ClF3N3O — CID 109163462
N-(3-chlorophenyl)-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide (PubChem CID 109163462) has the molecular formula C18H11ClF3N3O and a molecular weight of 377.75 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide.
| Compound Name | N-(3-chlorophenyl)-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109163462 |
| Molecular Formula | C18H11ClF3N3O |
| Molecular Weight | 377.75 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-(3-chlorophenyl)-6-(2,3,4-trifluoroanilino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(Nc2ccc(F)c(F)c2F)nc1 |
| InChI | InChI=1S/C18H11ClF3N3O/c19-11-2-1-3-12(8-11)24-18(26)10-4-7-15(23-9-10)25-14-6-5-13(20)16(21)17(14)22/h1-9H,(H,23,25)(H,24,26) |
| InChIKey | TVTQIYVJSRMOPY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.75 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|