C18H13Cl2N3O — CID 109162127
6-(3,5-dichloroanilino)-N-phenylpyridine-3-carboxamide (PubChem CID 109162127) has the molecular formula C18H13Cl2N3O and a molecular weight of 358.23 g/mol. Its IUPAC name is 6-(3,5-dichloroanilino)-N-phenylpyridine-3-carboxamide.
| Compound Name | 6-(3,5-dichloroanilino)-N-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109162127 |
| Molecular Formula | C18H13Cl2N3O |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 6-(3,5-dichloroanilino)-N-phenylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(Nc2cc(Cl)cc(Cl)c2)nc1 |
| InChI | InChI=1S/C18H13Cl2N3O/c19-13-8-14(20)10-16(9-13)22-17-7-6-12(11-21-17)18(24)23-15-4-2-1-3-5-15/h1-11H,(H,21,22)(H,23,24) |
| InChIKey | BQBARGHOGWSYFE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |