C20H12F3N5O — CID 109359773
6-(quinolin-8-ylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide (PubChem CID 109359773) has the molecular formula C20H12F3N5O and a molecular weight of 395.34 g/mol. Its IUPAC name is 6-(quinolin-8-ylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(quinolin-8-ylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109359773 |
| Molecular Formula | C20H12F3N5O |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 6-(quinolin-8-ylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1cc(Nc2cccc3cccnc23)ncn1 |
| InChI | InChI=1S/C20H12F3N5O/c21-12-6-7-13(18(23)17(12)22)28-20(29)15-9-16(26-10-25-15)27-14-5-1-3-11-4-2-8-24-19(11)14/h1-10H,(H,28,29)(H,25,26,27) |
| InChIKey | MGBGSXYMEOZBJQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|