C21H15N5O3 — CID 109359721
6-(1,3-benzodioxol-5-ylamino)-N-quinolin-8-ylpyrimidine-4-carboxamide (PubChem CID 109359721) has the molecular formula C21H15N5O3 and a molecular weight of 385.38 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylamino)-N-quinolin-8-ylpyrimidine-4-carboxamide.
| Compound Name | 6-(1,3-benzodioxol-5-ylamino)-N-quinolin-8-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109359721 |
| Molecular Formula | C21H15N5O3 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylamino)-N-quinolin-8-ylpyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)c1cc(Nc2ccc3c(c2)OCO3)ncn1 |
| InChI | InChI=1S/C21H15N5O3/c27-21(26-15-5-1-3-13-4-2-8-22-20(13)15)16-10-19(24-11-23-16)25-14-6-7-17-18(9-14)29-12-28-17/h1-11H,12H2,(H,26,27)(H,23,24,25) |
| InChIKey | BZSQLKVDKLSBQE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |