C19H18N4S — CID 2424034
1-(2,4-dimethylphenyl)-3-(quinolin-6-ylmethylideneamino)thiourea (PubChem CID 2424034) has the molecular formula C19H18N4S and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-(quinolin-6-ylmethylideneamino)thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-(quinolin-6-ylmethylideneamino)thiourea |
|---|---|
| PubChem CID | 2424034 |
| Molecular Formula | C19H18N4S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-(quinolin-6-ylmethylideneamino)thiourea |
| SMILES | Cc1ccc(NC(=S)NN=Cc2ccc3ncccc3c2)c(C)c1 |
| InChI | InChI=1S/C19H18N4S/c1-13-5-7-17(14(2)10-13)22-19(24)23-21-12-15-6-8-18-16(11-15)4-3-9-20-18/h3-12H,1-2H3,(H2,22,23,24) |
| InChIKey | WFBYGAMLVVCWQR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|