C19H17N3S — CID 7933456
1-(2-methylphenyl)-3-[(Z)-naphthalen-2-ylmethylideneamino]thiourea (PubChem CID 7933456) has the molecular formula C19H17N3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[(Z)-naphthalen-2-ylmethylideneamino]thiourea.
| Compound Name | 1-(2-methylphenyl)-3-[(Z)-naphthalen-2-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 7933456 |
| Molecular Formula | C19H17N3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-(2-methylphenyl)-3-[(Z)-naphthalen-2-ylmethylideneamino]thiourea |
| SMILES | Cc1ccccc1NC(=S)N/N=C\c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H17N3S/c1-14-6-2-5-9-18(14)21-19(23)22-20-13-15-10-11-16-7-3-4-8-17(16)12-15/h2-13H,1H3,(H2,21,22,23)/b20-13- |
| InChIKey | RTQSMFBJNGQGLV-MOSHPQCFSA-N |
| XLogP | 4.47 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_naphth_A(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|