C16H17N3S2 — CID 7933541
1-(2-methylphenyl)-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea (PubChem CID 7933541) has the molecular formula C16H17N3S2 and a molecular weight of 315.47 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea.
| Compound Name | 1-(2-methylphenyl)-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 7933541 |
| Molecular Formula | C16H17N3S2 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-(2-methylphenyl)-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea |
| SMILES | CSc1ccc(/C=N\NC(=S)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C16H17N3S2/c1-12-5-3-4-6-15(12)18-16(20)19-17-11-13-7-9-14(21-2)10-8-13/h3-11H,1-2H3,(H2,18,19,20)/b17-11- |
| InChIKey | FZNMJHOWVCJRJJ-BOPFTXTBSA-N |
| XLogP | 4.04 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|