C15H21N3S2 — CID 5149342
1-cyclohexyl-3-[(4-methylsulfanylphenyl)methylideneamino]thiourea (PubChem CID 5149342) has the molecular formula C15H21N3S2 and a molecular weight of 307.49 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(4-methylsulfanylphenyl)methylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(4-methylsulfanylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 5149342 |
| Molecular Formula | C15H21N3S2 |
| Molecular Weight | 307.49 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-cyclohexyl-3-[(4-methylsulfanylphenyl)methylideneamino]thiourea |
| SMILES | CSc1ccc(C=NNC(=S)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C15H21N3S2/c1-20-14-9-7-12(8-10-14)11-16-18-15(19)17-13-5-3-2-4-6-13/h7-11,13H,2-6H2,1H3,(H2,17,18,19) |
| InChIKey | MVUYRKKQTZDUAL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|