C15H19N3O2S — CID 6861405
1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-cyclohexylthiourea (PubChem CID 6861405) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-cyclohexylthiourea.
| Compound Name | 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 6861405 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-cyclohexylthiourea |
| SMILES | S=C(N/N=C/c1ccc2c(c1)OCO2)NC1CCCCC1 |
| InChI | InChI=1S/C15H19N3O2S/c21-15(17-12-4-2-1-3-5-12)18-16-9-11-6-7-13-14(8-11)20-10-19-13/h6-9,12H,1-5,10H2,(H2,17,18,21)/b16-9+ |
| InChIKey | CLTZTXNVQYXKIO-CXUHLZMHSA-N |
| XLogP | 2.55 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|