C17H19N3S2 — CID 6186581
1-(2,3-dimethylphenyl)-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea (PubChem CID 6186581) has the molecular formula C17H19N3S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6186581 |
| Molecular Formula | C17H19N3S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea |
| SMILES | CSc1ccc(/C=N\NC(=S)Nc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C17H19N3S2/c1-12-5-4-6-16(13(12)2)19-17(21)20-18-11-14-7-9-15(22-3)10-8-14/h4-11H,1-3H3,(H2,19,20,21)/b18-11- |
| InChIKey | YSSLKEGYCLIGSD-WQRHYEAKSA-N |
| XLogP | 4.35 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|