C29H26F3N5OS — CID 144775050
ethane;1-(2-methylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea (PubChem CID 144775050) has the molecular formula C29H26F3N5OS and a molecular weight of 549.62 g/mol. Its IUPAC name is ethane;1-(2-methylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea.
| Compound Name | ethane;1-(2-methylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 144775050 |
| Molecular Formula | C29H26F3N5OS |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | ethane;1-(2-methylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea |
| SMILES | CC.Cc1ccccc1NC(=S)N/N=C/c1ccc2c(ccc3c2ncn3-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H20F3N5OS.C2H6/c1-17-4-2-3-5-23(17)33-26(37)34-32-15-18-6-12-22-19(14-18)7-13-24-25(22)31-16-35(24)20-8-10-21(11-9-20)36-27(28,29)30;1-2/h2-16H,1H3,(H2,33,34,37);1-2H3/b32-15+; |
| InChIKey | OTZCGUVVJGAMJK-VMKKQKLVSA-N |
| XLogP | 7.73 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|