C28H19F3IN3OS — CID 160865045
1-(2-iodophenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]propane-2-thione (PubChem CID 160865045) has the molecular formula C28H19F3IN3OS and a molecular weight of 629.44 g/mol. Its IUPAC name is 1-(2-iodophenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]propane-2-thione.
| Compound Name | 1-(2-iodophenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]propane-2-thione |
|---|---|
| PubChem CID | 160865045 |
| Molecular Formula | C28H19F3IN3OS |
| Molecular Weight | 629.44 g/mol |
| Exact Mass | 629.02 |
| IUPAC Name | 1-(2-iodophenyl)-3-[[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]methylideneamino]propane-2-thione |
| SMILES | FC(F)(F)Oc1ccc(-n2cnc3c4ccc(/C=N/CC(=S)Cc5ccccc5I)cc4ccc32)cc1 |
| InChI | InChI=1S/C28H19F3IN3OS/c29-28(30,31)36-22-9-7-21(8-10-22)35-17-34-27-24-11-5-18(13-19(24)6-12-26(27)35)15-33-16-23(37)14-20-3-1-2-4-25(20)32/h1-13,15,17H,14,16H2/b33-15+ |
| InChIKey | SKZOFUNTHRAREA-ROPCREHHSA-N |
| XLogP | 7.71 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.44 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|