C27H17ClF6N5OS+ — CID 121376614
[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylamino]-methylidene-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]azanium (PubChem CID 121376614) has the molecular formula C27H17ClF6N5OS+ and a molecular weight of 608.98 g/mol. Its IUPAC name is [[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylamino]-methylidene-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]azanium.
| Compound Name | [[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylamino]-methylidene-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]azanium |
|---|---|
| PubChem CID | 121376614 |
| Molecular Formula | C27H17ClF6N5OS+ |
| Molecular Weight | 608.98 g/mol |
| Exact Mass | 608.07 |
| IUPAC Name | [[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylamino]-methylidene-[3-[4-(trifluoromethoxy)phenyl]benzo[e]benzimidazol-7-yl]azanium |
| SMILES | C=[N+](NC(=S)Nc1cc(C(F)(F)F)ccc1Cl)c1ccc2c(ccc3c2ncn3-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H16ClF6N5OS/c1-38(37-25(41)36-22-13-16(26(29,30)31)3-10-21(22)28)18-6-9-20-15(12-18)2-11-23-24(20)35-14-39(23)17-4-7-19(8-5-17)40-27(32,33)34/h2-14H,1H2,(H-,36,37,41)/p+1 |
| InChIKey | IAPFCYQXLHIHMX-UHFFFAOYSA-O |
| XLogP | 8.00 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.98 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|