C29H25F3N6OS — CID 121484707
1-(5-methyl-2-propan-2-ylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]imidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea (PubChem CID 121484707) has the molecular formula C29H25F3N6OS and a molecular weight of 562.62 g/mol. Its IUPAC name is 1-(5-methyl-2-propan-2-ylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]imidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea.
| Compound Name | 1-(5-methyl-2-propan-2-ylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]imidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 121484707 |
| Molecular Formula | C29H25F3N6OS |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 1-(5-methyl-2-propan-2-ylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]imidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea |
| SMILES | Cc1ccc(C(C)C)c(NC(=S)N/N=C/c2ccc3c(ccc4c3ncn4-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C29H25F3N6OS/c1-17(2)22-10-4-18(3)14-25(22)36-28(40)37-34-15-19-5-11-23-24(35-19)12-13-26-27(23)33-16-38(26)20-6-8-21(9-7-20)39-29(30,31)32/h4-17H,1-3H3,(H2,36,37,40)/b34-15+ |
| InChIKey | BRLJBBFYIROCOP-PUHLOBNQSA-N |
| XLogP | 7.22 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|