C27H23F3N6OS — CID 140829602
1-(2,6-dimethylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydroimidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea (PubChem CID 140829602) has the molecular formula C27H23F3N6OS and a molecular weight of 536.58 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydroimidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydroimidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 140829602 |
| Molecular Formula | C27H23F3N6OS |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydroimidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)N/N=C/c1ccc2c(n1)CCc1c-2ncn1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C27H23F3N6OS/c1-16-4-3-5-17(2)24(16)34-26(38)35-32-14-18-6-11-21-22(33-18)12-13-23-25(21)31-15-36(23)19-7-9-20(10-8-19)37-27(28,29)30/h3-11,14-15H,12-13H2,1-2H3,(H2,34,35,38)/b32-14+ |
| InChIKey | FBPKXUCSBJATGF-HIWRWHBISA-N |
| XLogP | 5.87 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|