C27H23F3N6OS — CID 135359102
1-(2,6-dimethylphenyl)-3-[(E)-[4-[4-(trifluoromethoxy)phenyl]-4,5-dihydro-3H-imidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea (PubChem CID 135359102) has the molecular formula C27H23F3N6OS and a molecular weight of 536.58 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(E)-[4-[4-(trifluoromethoxy)phenyl]-4,5-dihydro-3H-imidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(E)-[4-[4-(trifluoromethoxy)phenyl]-4,5-dihydro-3H-imidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 135359102 |
| Molecular Formula | C27H23F3N6OS |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(E)-[4-[4-(trifluoromethoxy)phenyl]-4,5-dihydro-3H-imidazo[4,5-f]quinolin-7-yl]methylideneamino]thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)N/N=C/c1ccc2c(n1)CC(c1ccc(OC(F)(F)F)cc1)c1[nH]cnc1-2 |
| InChI | InChI=1S/C27H23F3N6OS/c1-15-4-3-5-16(2)23(15)35-26(38)36-33-13-18-8-11-20-22(34-18)12-21(25-24(20)31-14-32-25)17-6-9-19(10-7-17)37-27(28,29)30/h3-11,13-14,21H,12H2,1-2H3,(H,31,32)(H2,35,36,38)/b33-13+ |
| InChIKey | JCCVZZOGLASKAY-IIHBXENTSA-N |
| XLogP | 6.00 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|