C26H23F3N6O2S — CID 86668721
1-(4-methoxy-2,6-dimethylphenyl)-3-[(Z)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 86668721) has the molecular formula C26H23F3N6O2S and a molecular weight of 540.57 g/mol. Its IUPAC name is 1-(4-methoxy-2,6-dimethylphenyl)-3-[(Z)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-(4-methoxy-2,6-dimethylphenyl)-3-[(Z)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 86668721 |
| Molecular Formula | C26H23F3N6O2S |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 1-(4-methoxy-2,6-dimethylphenyl)-3-[(Z)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | COc1cc(C)c(NC(=S)N/N=C\c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C26H23F3N6O2S/c1-16-12-22(36-3)13-17(2)23(16)32-25(38)33-31-14-18-4-6-19(7-5-18)24-30-15-35(34-24)20-8-10-21(11-9-20)37-26(27,28)29/h4-15H,1-3H3,(H2,32,33,38)/b31-14- |
| InChIKey | LSPUJSFZBGQLTR-AQLQTECXSA-N |
| XLogP | 5.78 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|