C25H20ClF3N6OS — CID 88590338
1-(2-chloro-4,6-dimethylphenyl)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 88590338) has the molecular formula C25H20ClF3N6OS and a molecular weight of 544.99 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethylphenyl)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-(2-chloro-4,6-dimethylphenyl)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 88590338 |
| Molecular Formula | C25H20ClF3N6OS |
| Molecular Weight | 544.99 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 1-(2-chloro-4,6-dimethylphenyl)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | Cc1cc(C)c(NC(=S)N/N=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C25H20ClF3N6OS/c1-15-11-16(2)22(21(26)12-15)32-24(37)33-31-13-17-3-5-18(6-4-17)23-30-14-35(34-23)19-7-9-20(10-8-19)36-25(27,28)29/h3-14H,1-2H3,(H2,32,33,37)/b31-13+ |
| InChIKey | LZRAHOJKDKOWOR-IURWMYGYSA-N |
| XLogP | 6.42 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.99 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|