C24H16F6N6O2S — CID 123306311
1-[4-(trifluoromethoxy)phenyl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 123306311) has the molecular formula C24H16F6N6O2S and a molecular weight of 566.49 g/mol. Its IUPAC name is 1-[4-(trifluoromethoxy)phenyl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-[4-(trifluoromethoxy)phenyl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 123306311 |
| Molecular Formula | C24H16F6N6O2S |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | 1-[4-(trifluoromethoxy)phenyl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | FC(F)(F)Oc1ccc(NC(=S)NN=Cc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C24H16F6N6O2S/c25-23(26,27)37-19-9-5-17(6-10-19)33-22(39)34-32-13-15-1-3-16(4-2-15)21-31-14-36(35-21)18-7-11-20(12-8-18)38-24(28,29)30/h1-14H,(H2,33,34,39) |
| InChIKey | CMEOXOUUOBCLNI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|