C23H20F3N9OS — CID 123779627
1-[2-(dimethylamino)pyrimidin-5-yl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 123779627) has the molecular formula C23H20F3N9OS and a molecular weight of 527.54 g/mol. Its IUPAC name is 1-[2-(dimethylamino)pyrimidin-5-yl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-[2-(dimethylamino)pyrimidin-5-yl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 123779627 |
| Molecular Formula | C23H20F3N9OS |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 1-[2-(dimethylamino)pyrimidin-5-yl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | CN(C)c1ncc(NC(=S)NN=Cc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)cn1 |
| InChI | InChI=1S/C23H20F3N9OS/c1-34(2)21-27-12-17(13-28-21)31-22(37)32-30-11-15-3-5-16(6-4-15)20-29-14-35(33-20)18-7-9-19(10-8-18)36-23(24,25)26/h3-14H,1-2H3,(H2,31,32,37) |
| InChIKey | IWQGEZPIGZBCGW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|