C26H22F3N7O2S — CID 123838258
N-methyl-N-[4-[[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamothioylamino]phenyl]acetamide (PubChem CID 123838258) has the molecular formula C26H22F3N7O2S and a molecular weight of 553.57 g/mol. Its IUPAC name is N-methyl-N-[4-[[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamothioylamino]phenyl]acetamide.
| Compound Name | N-methyl-N-[4-[[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 123838258 |
| Molecular Formula | C26H22F3N7O2S |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | N-methyl-N-[4-[[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]carbamothioylamino]phenyl]acetamide |
| SMILES | CC(=O)N(C)c1ccc(NC(=S)NN=Cc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C26H22F3N7O2S/c1-17(37)35(2)21-9-7-20(8-10-21)32-25(39)33-31-15-18-3-5-19(6-4-18)24-30-16-36(34-24)22-11-13-23(14-12-22)38-26(27,28)29/h3-16H,1-2H3,(H2,32,33,39) |
| InChIKey | BDHQFAUSNKETQM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|