C26H21F6N7OS — CID 123328158
1-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 123328158) has the molecular formula C26H21F6N7OS and a molecular weight of 593.56 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 123328158 |
| Molecular Formula | C26H21F6N7OS |
| Molecular Weight | 593.56 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | 1-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | CN(C)c1ccc(NC(=S)NN=Cc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H21F6N7OS/c1-38(2)19-9-12-22(21(13-19)25(27,28)29)35-24(41)36-34-14-16-3-5-17(6-4-16)23-33-15-39(37-23)18-7-10-20(11-8-18)40-26(30,31)32/h3-15H,1-2H3,(H2,35,36,41) |
| InChIKey | QJGZPYOXNOZQFA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|