C25H21F3N6O3S — CID 88590283
1-(2,4-dimethoxyphenyl)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 88590283) has the molecular formula C25H21F3N6O3S and a molecular weight of 542.54 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 88590283 |
| Molecular Formula | C25H21F3N6O3S |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | COc1ccc(NC(=S)N/N=C/c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H21F3N6O3S/c1-35-20-11-12-21(22(13-20)36-2)31-24(38)32-30-14-16-3-5-17(6-4-16)23-29-15-34(33-23)18-7-9-19(10-8-18)37-25(26,27)28/h3-15H,1-2H3,(H2,31,32,38)/b30-14+ |
| InChIKey | YQZNQCUWPXGROO-AMVVHIIESA-N |
| XLogP | 5.17 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|