C23H23F3N6OS — CID 123565567
1-cyclohexyl-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 123565567) has the molecular formula C23H23F3N6OS and a molecular weight of 488.54 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 123565567 |
| Molecular Formula | C23H23F3N6OS |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 1-cyclohexyl-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | FC(F)(F)Oc1ccc(-n2cnc(-c3ccc(C=NNC(=S)NC4CCCCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C23H23F3N6OS/c24-23(25,26)33-20-12-10-19(11-13-20)32-15-27-21(31-32)17-8-6-16(7-9-17)14-28-30-22(34)29-18-4-2-1-3-5-18/h6-15,18H,1-5H2,(H2,29,30,34) |
| InChIKey | FKLXUGMOEQPZHF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|