C22H24F3N7OS — CID 88590259
1-[3-(dimethylamino)propyl]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 88590259) has the molecular formula C22H24F3N7OS and a molecular weight of 491.54 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 88590259 |
| Molecular Formula | C22H24F3N7OS |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | CN(C)CCCNC(=S)N/N=C/c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C22H24F3N7OS/c1-31(2)13-3-12-26-21(34)29-28-14-16-4-6-17(7-5-16)20-27-15-32(30-20)18-8-10-19(11-9-18)33-22(23,24)25/h4-11,14-15H,3,12-13H2,1-2H3,(H2,26,29,34)/b28-14+ |
| InChIKey | PPIWUHRAWPGTRU-CCVNUDIWSA-N |
| XLogP | 3.58 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|