C24H17Cl2F3N6O2S — CID 123727064
1-(2,6-dichloro-4-methoxyphenyl)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 123727064) has the molecular formula C24H17Cl2F3N6O2S and a molecular weight of 581.41 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-methoxyphenyl)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-(2,6-dichloro-4-methoxyphenyl)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 123727064 |
| Molecular Formula | C24H17Cl2F3N6O2S |
| Molecular Weight | 581.41 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | 1-(2,6-dichloro-4-methoxyphenyl)-3-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | COc1cc(Cl)c(NC(=S)NN=Cc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C24H17Cl2F3N6O2S/c1-36-18-10-19(25)21(20(26)11-18)32-23(38)33-31-12-14-2-4-15(5-3-14)22-30-13-35(34-22)16-6-8-17(9-7-16)37-24(27,28)29/h2-13H,1H3,(H2,32,33,38) |
| InChIKey | XZFWCRUHNRVIJO-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.41 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|