C26H23F3N6O2 — CID 77410107
1-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-(2,4,6-trimethylphenyl)urea (PubChem CID 77410107) has the molecular formula C26H23F3N6O2 and a molecular weight of 508.50 g/mol. Its IUPAC name is 1-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 77410107 |
| Molecular Formula | C26H23F3N6O2 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 1-[[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NN=Cc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C26H23F3N6O2/c1-16-12-17(2)23(18(3)13-16)32-25(36)33-31-14-19-4-6-20(7-5-19)24-30-15-35(34-24)21-8-10-22(11-9-21)37-26(27,28)29/h4-15H,1-3H3,(H2,32,33,36) |
| InChIKey | HLDHEBYFHCTNDP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|